C30H27Cl2N3O2S — CID 7005308
ethyl 5,7-dichloro-4-[4-[(5R)-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazin-1-yl]quinoline-2-carboxylate (PubChem CID 7005308) has the molecular formula C30H27Cl2N3O2S and a molecular weight of 564.54 g/mol. Its IUPAC name is ethyl 5,7-dichloro-4-[4-[(5R)-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazin-1-yl]quinoline-2-carboxylate.
| Compound Name | ethyl 5,7-dichloro-4-[4-[(5R)-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazin-1-yl]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 7005308 |
| Molecular Formula | C30H27Cl2N3O2S |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | ethyl 5,7-dichloro-4-[4-[(5R)-5,6-dihydrobenzo[b][1]benzothiepin-5-yl]piperazin-1-yl]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc(N2CCN([C@@H]3Cc4ccccc4Sc4ccccc43)CC2)c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C30H27Cl2N3O2S/c1-2-37-30(36)24-18-26(29-22(32)16-20(31)17-23(29)33-24)35-13-11-34(12-14-35)25-15-19-7-3-5-9-27(19)38-28-10-6-4-8-21(25)28/h3-10,16-18,25H,2,11-15H2,1H3/t25-/m1/s1 |
| InChIKey | NZQJJTWDYUGEQL-RUZDIDTESA-N |
| XLogP | 7.29 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|