C28H31ClN2O9S — CID 6446722
bis((E)-but-2-enedioic acid);1-(3-chloro-2-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine (PubChem CID 6446722) has the molecular formula C28H31ClN2O9S and a molecular weight of 607.08 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);1-(3-chloro-2-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine.
| Compound Name | bis((E)-but-2-enedioic acid);1-(3-chloro-2-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 6446722 |
| Molecular Formula | C28H31ClN2O9S |
| Molecular Weight | 607.08 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | bis((E)-but-2-enedioic acid);1-(3-chloro-2-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine |
| SMILES | COc1cc2c(cc1Cl)C(N1CCN(C)CC1)Cc1ccccc1S2.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H23ClN2OS.2C4H4O4/c1-22-7-9-23(10-8-22)17-11-14-5-3-4-6-19(14)25-20-13-18(24-2)16(21)12-15(17)20;2*5-3(6)1-2-4(7)8/h3-6,12-13,17H,7-11H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | IQLPLUQYKQVJRL-LVEZLNDCSA-N |
| XLogP | 3.77 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.08 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|