C25H32N2O7S — CID 20840931
(Z)-but-2-enedioic acid;1-(2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;hydrate (PubChem CID 20840931) has the molecular formula C25H32N2O7S and a molecular weight of 504.61 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;hydrate.
| Compound Name | (Z)-but-2-enedioic acid;1-(2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;hydrate |
|---|---|
| PubChem CID | 20840931 |
| Molecular Formula | C25H32N2O7S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;hydrate |
| SMILES | COc1cc2c(cc1OC)C(N1CCN(C)CC1)Cc1ccccc1S2.O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H26N2O2S.C4H4O4.H2O/c1-22-8-10-23(11-9-22)17-12-15-6-4-5-7-20(15)26-21-14-19(25-3)18(24-2)13-16(17)21;5-3(6)1-2-4(7)8;/h4-7,13-14,17H,8-12H2,1-3H3;1-2H,(H,5,6)(H,7,8);1H2/b;2-1-; |
| InChIKey | ZLNSPFJBKLZUQO-FJOGWHKWSA-N |
| XLogP | 2.59 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|