C27H33N3O5S — CID 163332582
(Z)-but-2-enedioic acid;4-[5-(4-methylpiperazin-1-yl)-5,6-dihydrobenzo[b][1]benzothiepin-3-yl]morpholine (PubChem CID 163332582) has the molecular formula C27H33N3O5S and a molecular weight of 511.64 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-[5-(4-methylpiperazin-1-yl)-5,6-dihydrobenzo[b][1]benzothiepin-3-yl]morpholine.
| Compound Name | (Z)-but-2-enedioic acid;4-[5-(4-methylpiperazin-1-yl)-5,6-dihydrobenzo[b][1]benzothiepin-3-yl]morpholine |
|---|---|
| PubChem CID | 163332582 |
| Molecular Formula | C27H33N3O5S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-[5-(4-methylpiperazin-1-yl)-5,6-dihydrobenzo[b][1]benzothiepin-3-yl]morpholine |
| SMILES | CN1CCN(C2Cc3ccccc3Sc3ccc(N4CCOCC4)cc32)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C23H29N3OS.C4H4O4/c1-24-8-10-26(11-9-24)21-16-18-4-2-3-5-22(18)28-23-7-6-19(17-20(21)23)25-12-14-27-15-13-25;5-3(6)1-2-4(7)8/h2-7,17,21H,8-16H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DTEZVNPKECXPJC-BTJKTKAUSA-N |
| XLogP | 3.23 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|