C11H15ClN2O4 — CID 137333254
diethyl 4-aminopyridine-2,6-dicarboxylate;hydrochloride (PubChem CID 137333254) has the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. Its IUPAC name is diethyl 4-aminopyridine-2,6-dicarboxylate;hydrochloride.
| Compound Name | diethyl 4-aminopyridine-2,6-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 137333254 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | diethyl 4-aminopyridine-2,6-dicarboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cc(N)cc(C(=O)OCC)n1.Cl |
| InChI | InChI=1S/C11H14N2O4.ClH/c1-3-16-10(14)8-5-7(12)6-9(13-8)11(15)17-4-2;/h5-6H,3-4H2,1-2H3,(H2,12,13);1H |
| InChIKey | JNILXLRUCNZHOZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |