C36H32N2O8S2 — CID 102149888
diethyl 4-[5-[4-[5-[2,6-bis(ethoxycarbonyl)-4-pyridinyl]thiophen-2-yl]phenyl]thiophen-2-yl]pyridine-2,6-dicarboxylate (PubChem CID 102149888) has the molecular formula C36H32N2O8S2 and a molecular weight of 684.79 g/mol. Its IUPAC name is diethyl 4-[5-[4-[5-[2,6-bis(ethoxycarbonyl)-4-pyridinyl]thiophen-2-yl]phenyl]thiophen-2-yl]pyridine-2,6-dicarboxylate.
| Compound Name | diethyl 4-[5-[4-[5-[2,6-bis(ethoxycarbonyl)-4-pyridinyl]thiophen-2-yl]phenyl]thiophen-2-yl]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 102149888 |
| Molecular Formula | C36H32N2O8S2 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.16 |
| IUPAC Name | diethyl 4-[5-[4-[5-[2,6-bis(ethoxycarbonyl)-4-pyridinyl]thiophen-2-yl]phenyl]thiophen-2-yl]pyridine-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(-c3ccc(-c4ccc(-c5cc(C(=O)OCC)nc(C(=O)OCC)c5)s4)cc3)s2)cc(C(=O)OCC)n1 |
| InChI | InChI=1S/C36H32N2O8S2/c1-5-43-33(39)25-17-23(18-26(37-25)34(40)44-6-2)31-15-13-29(47-31)21-9-11-22(12-10-21)30-14-16-32(48-30)24-19-27(35(41)45-7-3)38-28(20-24)36(42)46-8-4/h9-20H,5-8H2,1-4H3 |
| InChIKey | KTXZPHQFLCUWLQ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|