C18H19NO5S — CID 2746946
diethyl 4-(3-methoxyphenyl)sulfanylpyridine-2,6-dicarboxylate (PubChem CID 2746946) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is diethyl 4-(3-methoxyphenyl)sulfanylpyridine-2,6-dicarboxylate.
| Compound Name | diethyl 4-(3-methoxyphenyl)sulfanylpyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 2746946 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | diethyl 4-(3-methoxyphenyl)sulfanylpyridine-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc(Sc2cccc(OC)c2)cc(C(=O)OCC)n1 |
| InChI | InChI=1S/C18H19NO5S/c1-4-23-17(20)15-10-14(11-16(19-15)18(21)24-5-2)25-13-8-6-7-12(9-13)22-3/h6-11H,4-5H2,1-3H3 |
| InChIKey | ILBKJZFDQRQWOM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |