C23H24Cl2N2O3 — CID 19735189
2-(diethylamino)ethyl 5,7-dichloro-4-phenylmethoxyquinoline-2-carboxylate (PubChem CID 19735189) has the molecular formula C23H24Cl2N2O3 and a molecular weight of 447.36 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 5,7-dichloro-4-phenylmethoxyquinoline-2-carboxylate.
| Compound Name | 2-(diethylamino)ethyl 5,7-dichloro-4-phenylmethoxyquinoline-2-carboxylate |
|---|---|
| PubChem CID | 19735189 |
| Molecular Formula | C23H24Cl2N2O3 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-(diethylamino)ethyl 5,7-dichloro-4-phenylmethoxyquinoline-2-carboxylate |
| SMILES | CCN(CC)CCOC(=O)c1cc(OCc2ccccc2)c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C23H24Cl2N2O3/c1-3-27(4-2)10-11-29-23(28)20-14-21(30-15-16-8-6-5-7-9-16)22-18(25)12-17(24)13-19(22)26-20/h5-9,12-14H,3-4,10-11,15H2,1-2H3 |
| InChIKey | YTUUKSVFHZLTOL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |