C18H20ClNO2 — CID 8799985
5-chloro-N,N-diethyl-2-phenylmethoxybenzamide (PubChem CID 8799985) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is 5-chloro-N,N-diethyl-2-phenylmethoxybenzamide.
| Compound Name | 5-chloro-N,N-diethyl-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 8799985 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 5-chloro-N,N-diethyl-2-phenylmethoxybenzamide |
| SMILES | CCN(CC)C(=O)c1cc(Cl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H20ClNO2/c1-3-20(4-2)18(21)16-12-15(19)10-11-17(16)22-13-14-8-6-5-7-9-14/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | DQPLNSMDYITCNM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |