C20H17Cl2NO4S — CID 142634521
5,7-dichloro-4-(3-methoxy-3-phenylsulfanylpropoxy)quinoline-2-carboxylic acid (PubChem CID 142634521) has the molecular formula C20H17Cl2NO4S and a molecular weight of 438.33 g/mol. Its IUPAC name is 5,7-dichloro-4-(3-methoxy-3-phenylsulfanylpropoxy)quinoline-2-carboxylic acid.
| Compound Name | 5,7-dichloro-4-(3-methoxy-3-phenylsulfanylpropoxy)quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 142634521 |
| Molecular Formula | C20H17Cl2NO4S |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 5,7-dichloro-4-(3-methoxy-3-phenylsulfanylpropoxy)quinoline-2-carboxylic acid |
| SMILES | COC(CCOc1cc(C(=O)O)nc2cc(Cl)cc(Cl)c12)Sc1ccccc1 |
| InChI | InChI=1S/C20H17Cl2NO4S/c1-26-18(28-13-5-3-2-4-6-13)7-8-27-17-11-16(20(24)25)23-15-10-12(21)9-14(22)19(15)17/h2-6,9-11,18H,7-8H2,1H3,(H,24,25) |
| InChIKey | UOLMVYOQROSGHZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|