C21H20Cl2N4O3S — CID 142635732
5,7-dichloro-4-[3-[(4-methoxyphenyl)carbamothioylamino]propylamino]quinoline-2-carboxylic acid (PubChem CID 142635732) has the molecular formula C21H20Cl2N4O3S and a molecular weight of 479.39 g/mol. Its IUPAC name is 5,7-dichloro-4-[3-[(4-methoxyphenyl)carbamothioylamino]propylamino]quinoline-2-carboxylic acid.
| Compound Name | 5,7-dichloro-4-[3-[(4-methoxyphenyl)carbamothioylamino]propylamino]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 142635732 |
| Molecular Formula | C21H20Cl2N4O3S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 5,7-dichloro-4-[3-[(4-methoxyphenyl)carbamothioylamino]propylamino]quinoline-2-carboxylic acid |
| SMILES | COc1ccc(NC(=S)NCCCNc2cc(C(=O)O)nc3cc(Cl)cc(Cl)c23)cc1 |
| InChI | InChI=1S/C21H20Cl2N4O3S/c1-30-14-5-3-13(4-6-14)26-21(31)25-8-2-7-24-16-11-18(20(28)29)27-17-10-12(22)9-15(23)19(16)17/h3-6,9-11H,2,7-8H2,1H3,(H,24,27)(H,28,29)(H2,25,26,31) |
| InChIKey | ATOYXQPQFJUUBH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|