C26H25Cl2N7O3S — CID 174693805
2-[5-[2-(2,4-dichlorophenoxy)phenyl]tetrazol-5-yl]-N-[3-[(4-methoxyphenyl)carbamothioylamino]propyl]acetamide (PubChem CID 174693805) has the molecular formula C26H25Cl2N7O3S and a molecular weight of 586.51 g/mol. Its IUPAC name is 2-[5-[2-(2,4-dichlorophenoxy)phenyl]tetrazol-5-yl]-N-[3-[(4-methoxyphenyl)carbamothioylamino]propyl]acetamide.
| Compound Name | 2-[5-[2-(2,4-dichlorophenoxy)phenyl]tetrazol-5-yl]-N-[3-[(4-methoxyphenyl)carbamothioylamino]propyl]acetamide |
|---|---|
| PubChem CID | 174693805 |
| Molecular Formula | C26H25Cl2N7O3S |
| Molecular Weight | 586.51 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 2-[5-[2-(2,4-dichlorophenoxy)phenyl]tetrazol-5-yl]-N-[3-[(4-methoxyphenyl)carbamothioylamino]propyl]acetamide |
| SMILES | COc1ccc(NC(=S)NCCCNC(=O)CC2(c3ccccc3Oc3ccc(Cl)cc3Cl)N=NN=N2)cc1 |
| InChI | InChI=1S/C26H25Cl2N7O3S/c1-37-19-10-8-18(9-11-19)31-25(39)30-14-4-13-29-24(36)16-26(32-34-35-33-26)20-5-2-3-6-22(20)38-23-12-7-17(27)15-21(23)28/h2-3,5-12,15H,4,13-14,16H2,1H3,(H,29,36)(H2,30,31,39) |
| InChIKey | SDSODWPLYDFYCM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|