C24H23N7O2S — CID 174693736
2-[5-(2-phenoxyphenyl)tetrazol-5-yl]-N-[2-(phenylcarbamothioylamino)ethyl]acetamide (PubChem CID 174693736) has the molecular formula C24H23N7O2S and a molecular weight of 473.56 g/mol. Its IUPAC name is 2-[5-(2-phenoxyphenyl)tetrazol-5-yl]-N-[2-(phenylcarbamothioylamino)ethyl]acetamide.
| Compound Name | 2-[5-(2-phenoxyphenyl)tetrazol-5-yl]-N-[2-(phenylcarbamothioylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 174693736 |
| Molecular Formula | C24H23N7O2S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 2-[5-(2-phenoxyphenyl)tetrazol-5-yl]-N-[2-(phenylcarbamothioylamino)ethyl]acetamide |
| SMILES | O=C(CC1(c2ccccc2Oc2ccccc2)N=NN=N1)NCCNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C24H23N7O2S/c32-22(25-15-16-26-23(34)27-18-9-3-1-4-10-18)17-24(28-30-31-29-24)20-13-7-8-14-21(20)33-19-11-5-2-6-12-19/h1-14H,15-17H2,(H,25,32)(H2,26,27,34) |
| InChIKey | DBIYMAGEISOZBZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|