C26H21Cl2N3O4S — CID 142635714
5,7-dichloro-4-[3-[(4-phenoxyphenyl)carbamothioylamino]propoxy]quinoline-2-carboxylic acid (PubChem CID 142635714) has the molecular formula C26H21Cl2N3O4S and a molecular weight of 542.44 g/mol. Its IUPAC name is 5,7-dichloro-4-[3-[(4-phenoxyphenyl)carbamothioylamino]propoxy]quinoline-2-carboxylic acid.
| Compound Name | 5,7-dichloro-4-[3-[(4-phenoxyphenyl)carbamothioylamino]propoxy]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 142635714 |
| Molecular Formula | C26H21Cl2N3O4S |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | 5,7-dichloro-4-[3-[(4-phenoxyphenyl)carbamothioylamino]propoxy]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc(OCCCNC(=S)Nc2ccc(Oc3ccccc3)cc2)c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C26H21Cl2N3O4S/c27-16-13-20(28)24-21(14-16)31-22(25(32)33)15-23(24)34-12-4-11-29-26(36)30-17-7-9-19(10-8-17)35-18-5-2-1-3-6-18/h1-3,5-10,13-15H,4,11-12H2,(H,32,33)(H2,29,30,36) |
| InChIKey | QAPAFAXQTUQRSF-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|