C23H23N3OS2 — CID 71331106
1-[3-(3-methoxyphenothiazin-10-yl)propyl]-3-phenylthiourea (PubChem CID 71331106) has the molecular formula C23H23N3OS2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[3-(3-methoxyphenothiazin-10-yl)propyl]-3-phenylthiourea.
| Compound Name | 1-[3-(3-methoxyphenothiazin-10-yl)propyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 71331106 |
| Molecular Formula | C23H23N3OS2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-[3-(3-methoxyphenothiazin-10-yl)propyl]-3-phenylthiourea |
| SMILES | COc1ccc2c(c1)Sc1ccccc1N2CCCNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C23H23N3OS2/c1-27-18-12-13-20-22(16-18)29-21-11-6-5-10-19(21)26(20)15-7-14-24-23(28)25-17-8-3-2-4-9-17/h2-6,8-13,16H,7,14-15H2,1H3,(H2,24,25,28) |
| InChIKey | OOEUUGLVPKYULT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|