C10H11ClN2O4 — CID 175211532
(4-chloro-6-ethoxycarbonyl-2-pyridinyl)methylcarbamic acid (PubChem CID 175211532) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is (4-chloro-6-ethoxycarbonyl-2-pyridinyl)methylcarbamic acid.
| Compound Name | (4-chloro-6-ethoxycarbonyl-2-pyridinyl)methylcarbamic acid |
|---|---|
| PubChem CID | 175211532 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (4-chloro-6-ethoxycarbonyl-2-pyridinyl)methylcarbamic acid |
| SMILES | CCOC(=O)c1cc(Cl)cc(CNC(=O)O)n1 |
| InChI | InChI=1S/C10H11ClN2O4/c1-2-17-9(14)8-4-6(11)3-7(13-8)5-12-10(15)16/h3-4,12H,2,5H2,1H3,(H,15,16) |
| InChIKey | UEDYASANYQVINX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |