6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid

C15H15NO5 — CID 125488706

IUPAC6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid
SMILESCOc1cc(C(=O)O)nc(-c2ccc(OC)c(OC)c2)c1
InChIInChI=1S/C15H15NO5/c1-19-10-7-11(16-12(8-10)15(17)18)9-4-5-13(20-2)14(6-9)21-3/h4-8H,1-3H3,(H,17,18)
InChIKeySEVIHRWSAXXWJA-UHFFFAOYSA-N
MW289.29 g/mol
LogP2.47
Rot. Bonds5

About 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid

6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid (PubChem CID 125488706) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid
PubChem CID125488706
Molecular FormulaC15H15NO5
Molecular Weight289.29 g/mol
Exact Mass289.10
IUPAC Name6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid
SMILESCOc1cc(C(=O)O)nc(-c2ccc(OC)c(OC)c2)c1
InChIInChI=1S/C15H15NO5/c1-19-10-7-11(16-12(8-10)15(17)18)9-4-5-13(20-2)14(6-9)21-3/h4-8H,1-3H3,(H,17,18)
InChIKeySEVIHRWSAXXWJA-UHFFFAOYSA-N
XLogP2.47
TPSA77.88 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.29
LogP ≤ 52.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid?
The IUPAC name of 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid (CID 125488706) is 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid.
What is the SMILES notation for 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid?
The canonical SMILES for 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid is COc1cc(C(=O)O)nc(-c2ccc(OC)c(OC)c2)c1.
What is the InChIKey of 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid?
The InChIKey is SEVIHRWSAXXWJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO5/c1-19-10-7-11(16-12(8-10)15(17)18)9-4-5-13(20-2)14(6-9)21-3/h4-8H,1-3H3,(H,17,18).
What are the key properties of 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid?
6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid has a molecular weight of 289.29 g/mol, XLogP of 2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dimethoxyphenyl)-4-methoxypyridine-2-carboxylic acid is sourced from PubChem (CID 125488706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).