C13H13NO4S2 — CID 21408386
2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid (PubChem CID 21408386) has the molecular formula C13H13NO4S2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid |
|---|---|
| PubChem CID | 21408386 |
| Molecular Formula | C13H13NO4S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid |
| SMILES | COc1ccc(-c2csc(C(S)C(=O)O)n2)cc1OC |
| InChI | InChI=1S/C13H13NO4S2/c1-17-9-4-3-7(5-10(9)18-2)8-6-20-12(14-8)11(19)13(15)16/h3-6,11,19H,1-2H3,(H,15,16) |
| InChIKey | MNRAOPOVANPWAL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|