C13H14FNOS — CID 59333191
4-(3-fluoro-4-methoxyphenyl)-2-propan-2-yl-1,3-thiazole (PubChem CID 59333191) has the molecular formula C13H14FNOS and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-(3-fluoro-4-methoxyphenyl)-2-propan-2-yl-1,3-thiazole.
| Compound Name | 4-(3-fluoro-4-methoxyphenyl)-2-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 59333191 |
| Molecular Formula | C13H14FNOS |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-(3-fluoro-4-methoxyphenyl)-2-propan-2-yl-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(C(C)C)n2)cc1F |
| InChI | InChI=1S/C13H14FNOS/c1-8(2)13-15-11(7-17-13)9-4-5-12(16-3)10(14)6-9/h4-8H,1-3H3 |
| InChIKey | PPTOSBINTPCLMM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |