C12H13ClN2OS — CID 5162652
1-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 5162652) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 1-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 5162652 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 1-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | COc1ccc(-c2csc(C(C)N)n2)cc1Cl |
| InChI | InChI=1S/C12H13ClN2OS/c1-7(14)12-15-10(6-17-12)8-3-4-11(16-2)9(13)5-8/h3-7H,14H2,1-2H3 |
| InChIKey | SUDGITGHUIFNRB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |