C17H12ClNO2S2 — CID 21408462
2-chlorobicyclo[2.2.0]hexa-1(4),2,5-triene;2-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylacetic acid (PubChem CID 21408462) has the molecular formula C17H12ClNO2S2 and a molecular weight of 361.88 g/mol. Its IUPAC name is 2-chlorobicyclo[2.2.0]hexa-1(4),2,5-triene;2-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylacetic acid.
| Compound Name | 2-chlorobicyclo[2.2.0]hexa-1(4),2,5-triene;2-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylacetic acid |
|---|---|
| PubChem CID | 21408462 |
| Molecular Formula | C17H12ClNO2S2 |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 2-chlorobicyclo[2.2.0]hexa-1(4),2,5-triene;2-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylacetic acid |
| SMILES | Clc1cc2ccc1=2.O=C(O)C(S)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C11H9NO2S2.C6H3Cl/c13-11(14)9(15)10-12-8(6-16-10)7-4-2-1-3-5-7;7-6-3-4-1-2-5(4)6/h1-6,9,15H,(H,13,14);1-3H |
| InChIKey | YLTCTIGREZZATB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|