C19H16N2O6 — CID 18073695
5,7-dimethoxy-2-(4-methyl-3-nitrophenyl)quinoline-4-carboxylic acid (PubChem CID 18073695) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is 5,7-dimethoxy-2-(4-methyl-3-nitrophenyl)quinoline-4-carboxylic acid.
| Compound Name | 5,7-dimethoxy-2-(4-methyl-3-nitrophenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 18073695 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 5,7-dimethoxy-2-(4-methyl-3-nitrophenyl)quinoline-4-carboxylic acid |
| SMILES | COc1cc(OC)c2c(C(=O)O)cc(-c3ccc(C)c([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C19H16N2O6/c1-10-4-5-11(6-16(10)21(24)25)14-9-13(19(22)23)18-15(20-14)7-12(26-2)8-17(18)27-3/h4-9H,1-3H3,(H,22,23) |
| InChIKey | XCZVDWACLFBCOR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|