C27H22N2O5 — CID 1422767
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(3,4-dimethylphenyl)quinoline-4-carboxylate (PubChem CID 1422767) has the molecular formula C27H22N2O5 and a molecular weight of 454.48 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(3,4-dimethylphenyl)quinoline-4-carboxylate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(3,4-dimethylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 1422767 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(3,4-dimethylphenyl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)OCC(=O)c3ccc(C)c([N+](=O)[O-])c3)c3ccccc3n2)cc1C |
| InChI | InChI=1S/C27H22N2O5/c1-16-8-10-19(12-18(16)3)24-14-22(21-6-4-5-7-23(21)28-24)27(31)34-15-26(30)20-11-9-17(2)25(13-20)29(32)33/h4-14H,15H2,1-3H3 |
| InChIKey | GQJVFUALUUSTNL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|