C25H17ClN2O6 — CID 1418885
[2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate (PubChem CID 1418885) has the molecular formula C25H17ClN2O6 and a molecular weight of 476.87 g/mol. Its IUPAC name is [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 1418885 |
| Molecular Formula | C25H17ClN2O6 |
| Molecular Weight | 476.87 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 2-(4-methoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)OCC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H17ClN2O6/c1-33-17-9-6-15(7-10-17)22-13-19(18-4-2-3-5-21(18)27-22)25(30)34-14-24(29)16-8-11-20(26)23(12-16)28(31)32/h2-13H,14H2,1H3 |
| InChIKey | KJEOSWIYNVKUED-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.87 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|