C20H15NO7 — CID 7228497
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7228497) has the molecular formula C20H15NO7 and a molecular weight of 381.34 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7228497 |
| Molecular Formula | C20H15NO7 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cc(O)c3ccccc3c2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15NO7/c1-11-6-7-12(8-16(11)21(26)27)18(23)10-28-20(25)15-9-17(22)13-4-2-3-5-14(13)19(15)24/h2-9,22,24H,10H2,1H3 |
| InChIKey | VXCHRPFWPWTDNZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|