C24H22N2O5 — CID 7752579
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate (PubChem CID 7752579) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate |
|---|---|
| PubChem CID | 7752579 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccccc2Nc2cccc(C)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H22N2O5/c1-15-7-6-10-20(17(15)3)25-21-9-5-4-8-19(21)24(28)31-14-23(27)18-12-11-16(2)22(13-18)26(29)30/h4-13,25H,14H2,1-3H3 |
| InChIKey | YUXGSXBLKDKSJE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|