C34H27N3O7 — CID 4149644
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4149644) has the molecular formula C34H27N3O7 and a molecular weight of 589.60 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4149644 |
| Molecular Formula | C34H27N3O7 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)C5CC=CC(C)C5C4=O)cc3)nc3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C34H27N3O7/c1-19-10-11-22(16-29(19)37(42)43)30(38)18-44-34(41)26-17-28(35-27-9-4-3-7-24(26)27)21-12-14-23(15-13-21)36-32(39)25-8-5-6-20(2)31(25)33(36)40/h3-7,9-17,20,25,31H,8,18H2,1-2H3 |
| InChIKey | XEROWFLKGWXIHQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|