C17H18O7 — CID 141247390
2-(3,5-dimethoxyphenoxy)-4,5-dimethoxybenzoic acid (PubChem CID 141247390) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenoxy)-4,5-dimethoxybenzoic acid.
| Compound Name | 2-(3,5-dimethoxyphenoxy)-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 141247390 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(3,5-dimethoxyphenoxy)-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(OC)cc(Oc2cc(OC)c(OC)cc2C(=O)O)c1 |
| InChI | InChI=1S/C17H18O7/c1-20-10-5-11(21-2)7-12(6-10)24-14-9-16(23-4)15(22-3)8-13(14)17(18)19/h5-9H,1-4H3,(H,18,19) |
| InChIKey | QMDQASYEMUQJEQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |