2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid

C21H19NO8S — CID 21487311

IUPAC2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid
SMILESCOc1ccc(Oc2cc(Oc3ccc(OC)cc3)c(S(N)(=O)=O)cc2C(=O)O)cc1
InChIInChI=1S/C21H19NO8S/c1-27-13-3-7-15(8-4-13)29-18-12-19(30-16-9-5-14(28-2)6-10-16)20(31(22,25)26)11-17(18)21(23)24/h3-12H,1-2H3,(H,23,24)(H2,22,25,26)
InChIKeyGDUBYEMEFUEONT-UHFFFAOYSA-N
MW445.45 g/mol
LogP3.63
Rot. Bonds8

About 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid

2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid (PubChem CID 21487311) has the molecular formula C21H19NO8S and a molecular weight of 445.45 g/mol. Its IUPAC name is 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid.

Molecular Properties

Compound Name2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid
PubChem CID21487311
Molecular FormulaC21H19NO8S
Molecular Weight445.45 g/mol
Exact Mass445.08
IUPAC Name2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid
SMILESCOc1ccc(Oc2cc(Oc3ccc(OC)cc3)c(S(N)(=O)=O)cc2C(=O)O)cc1
InChIInChI=1S/C21H19NO8S/c1-27-13-3-7-15(8-4-13)29-18-12-19(30-16-9-5-14(28-2)6-10-16)20(31(22,25)26)11-17(18)21(23)24/h3-12H,1-2H3,(H,23,24)(H2,22,25,26)
InChIKeyGDUBYEMEFUEONT-UHFFFAOYSA-N
XLogP3.63
TPSA134.38 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms31
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500445.45
LogP ≤ 53.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Analyze 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid?
The IUPAC name of 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid (CID 21487311) is 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid.
What is the SMILES notation for 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid?
The canonical SMILES for 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid is COc1ccc(Oc2cc(Oc3ccc(OC)cc3)c(S(N)(=O)=O)cc2C(=O)O)cc1.
What is the InChIKey of 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid?
The InChIKey is GDUBYEMEFUEONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO8S/c1-27-13-3-7-15(8-4-13)29-18-12-19(30-16-9-5-14(28-2)6-10-16)20(31(22,25)26)11-17(18)21(23)24/h3-12H,1-2H3,(H,23,24)(H2,22,25,26).
What are the key properties of 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid?
2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid has a molecular weight of 445.45 g/mol, XLogP of 3.63, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid is sourced from PubChem (CID 21487311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).