C21H19NO6S — CID 21487307
2,4-bis(4-methylphenoxy)-5-sulfamoylbenzoic acid (PubChem CID 21487307) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is 2,4-bis(4-methylphenoxy)-5-sulfamoylbenzoic acid.
| Compound Name | 2,4-bis(4-methylphenoxy)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21487307 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2,4-bis(4-methylphenoxy)-5-sulfamoylbenzoic acid |
| SMILES | Cc1ccc(Oc2cc(Oc3ccc(C)cc3)c(S(N)(=O)=O)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H19NO6S/c1-13-3-7-15(8-4-13)27-18-12-19(28-16-9-5-14(2)6-10-16)20(29(22,25)26)11-17(18)21(23)24/h3-12H,1-2H3,(H,23,24)(H2,22,25,26) |
| InChIKey | NAVPIFVINDTLCO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |