C16H12F5NO4S — CID 140967698
4-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-5-sulfamoylbenzoic acid (PubChem CID 140967698) has the molecular formula C16H12F5NO4S and a molecular weight of 409.33 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-5-sulfamoylbenzoic acid.
| Compound Name | 4-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 140967698 |
| Molecular Formula | C16H12F5NO4S |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 4-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-5-sulfamoylbenzoic acid |
| SMILES | Cc1ccc(-c2cc(C(F)(F)C(F)(F)F)c(C(=O)O)cc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H12F5NO4S/c1-8-2-4-9(5-3-8)10-6-12(15(17,18)16(19,20)21)11(14(23)24)7-13(10)27(22,25)26/h2-7H,1H3,(H,23,24)(H2,22,25,26) |
| InChIKey | YEFUZAZZEIVDDD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|