C16H16BrN3O3S — CID 18976358
2-bromo-N-(diaminomethylidene)-4-(4-methylphenyl)-5-methylsulfonylbenzamide (PubChem CID 18976358) has the molecular formula C16H16BrN3O3S and a molecular weight of 410.29 g/mol. Its IUPAC name is 2-bromo-N-(diaminomethylidene)-4-(4-methylphenyl)-5-methylsulfonylbenzamide.
| Compound Name | 2-bromo-N-(diaminomethylidene)-4-(4-methylphenyl)-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 18976358 |
| Molecular Formula | C16H16BrN3O3S |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 2-bromo-N-(diaminomethylidene)-4-(4-methylphenyl)-5-methylsulfonylbenzamide |
| SMILES | Cc1ccc(-c2cc(Br)c(C(=O)N=C(N)N)cc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16BrN3O3S/c1-9-3-5-10(6-4-9)11-7-13(17)12(15(21)20-16(18)19)8-14(11)24(2,22)23/h3-8H,1-2H3,(H4,18,19,20,21) |
| InChIKey | OOYOJUWCHDVXOR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|