C17H19NO4S — CID 140967689
4-(4-methylphenyl)-2-propan-2-yl-5-sulfamoylbenzoic acid (PubChem CID 140967689) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-propan-2-yl-5-sulfamoylbenzoic acid.
| Compound Name | 4-(4-methylphenyl)-2-propan-2-yl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 140967689 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-(4-methylphenyl)-2-propan-2-yl-5-sulfamoylbenzoic acid |
| SMILES | Cc1ccc(-c2cc(C(C)C)c(C(=O)O)cc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-10(2)13-8-14(12-6-4-11(3)5-7-12)16(23(18,21)22)9-15(13)17(19)20/h4-10H,1-3H3,(H,19,20)(H2,18,21,22) |
| InChIKey | DKCGZFPDZVNRHV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |