C19H26N2O2S — CID 68534940
2-[4-amino-2,6-di(propan-2-yl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 68534940) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 2-[4-amino-2,6-di(propan-2-yl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | 2-[4-amino-2,6-di(propan-2-yl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 68534940 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[4-amino-2,6-di(propan-2-yl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)c(-c2c(C(C)C)cc(N)cc2C(C)C)c1 |
| InChI | InChI=1S/C19H26N2O2S/c1-11(2)15-9-14(20)10-16(12(3)4)19(15)17-8-13(5)6-7-18(17)24(21,22)23/h6-12H,20H2,1-5H3,(H2,21,22,23) |
| InChIKey | KPKNUCUGRFLJKK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|