C10H10N2O2S2 — CID 151398732
4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 151398732) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 151398732 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)c(-c2nccs2)c1 |
| InChI | InChI=1S/C10H10N2O2S2/c1-7-2-3-9(16(11,13)14)8(6-7)10-12-4-5-15-10/h2-6H,1H3,(H2,11,13,14) |
| InChIKey | OWAHWTDXKRYNQU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |