About 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide
4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 151398732) has the molecular formula C10H10N2O2S2
and a molecular weight of 254.34 g/mol. Its IUPAC name is 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide |
| PubChem CID | 151398732 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)c(-c2nccs2)c1 |
| InChI | InChI=1S/C10H10N2O2S2/c1-7-2-3-9(16(11,13)14)8(6-7)10-12-4-5-15-10/h2-6H,1H3,(H2,11,13,14) |
| InChIKey | OWAHWTDXKRYNQU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide?
The IUPAC name of 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide (CID 151398732) is 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide.
What is the SMILES notation for 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide?
The canonical SMILES for 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide is Cc1ccc(S(N)(=O)=O)c(-c2nccs2)c1.
What is the InChIKey of 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide?
The InChIKey is OWAHWTDXKRYNQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S2/c1-7-2-3-9(16(11,13)14)8(6-7)10-12-4-5-15-10/h2-6H,1H3,(H2,11,13,14).
What are the key properties of 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide?
4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide has a molecular weight of 254.34 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(1,3-thiazol-2-yl)benzenesulfonamide is sourced from PubChem (CID 151398732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).