C15H19N3O3S2 — CID 59506282
1-[4-morpholin-4-ylsulfonyl-3-(1,3-thiazol-2-yl)phenyl]ethanamine (PubChem CID 59506282) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[4-morpholin-4-ylsulfonyl-3-(1,3-thiazol-2-yl)phenyl]ethanamine.
| Compound Name | 1-[4-morpholin-4-ylsulfonyl-3-(1,3-thiazol-2-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 59506282 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-[4-morpholin-4-ylsulfonyl-3-(1,3-thiazol-2-yl)phenyl]ethanamine |
| SMILES | CC(N)c1ccc(S(=O)(=O)N2CCOCC2)c(-c2nccs2)c1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-11(16)12-2-3-14(13(10-12)15-17-4-9-22-15)23(19,20)18-5-7-21-8-6-18/h2-4,9-11H,5-8,16H2,1H3 |
| InChIKey | KUZWOPWDJFUWHL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |