C14H20ClN3O6S2 — CID 1161043
5-chloro-2,4-bis(morpholin-4-ylsulfonyl)aniline (PubChem CID 1161043) has the molecular formula C14H20ClN3O6S2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 5-chloro-2,4-bis(morpholin-4-ylsulfonyl)aniline.
| Compound Name | 5-chloro-2,4-bis(morpholin-4-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 1161043 |
| Molecular Formula | C14H20ClN3O6S2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 5-chloro-2,4-bis(morpholin-4-ylsulfonyl)aniline |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)N2CCOCC2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H20ClN3O6S2/c15-11-9-12(16)14(26(21,22)18-3-7-24-8-4-18)10-13(11)25(19,20)17-1-5-23-6-2-17/h9-10H,1-8,16H2 |
| InChIKey | ZLZILTLINPYESW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|