C12H13ClN4O3S2 — CID 8009164
5-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 8009164) has the molecular formula C12H13ClN4O3S2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 5-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 8009164 |
| Molecular Formula | C12H13ClN4O3S2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 5-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C12H13ClN4O3S2/c13-9-2-1-8(11-15-16-12(14)21-11)7-10(9)22(18,19)17-3-5-20-6-4-17/h1-2,7H,3-6H2,(H2,14,16) |
| InChIKey | RZSWYHHDHAGIHO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |