C11H13Cl2NO4S — CID 59093503
(2,5-dichloro-4-morpholin-4-ylsulfonylphenyl)methanol (PubChem CID 59093503) has the molecular formula C11H13Cl2NO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is (2,5-dichloro-4-morpholin-4-ylsulfonylphenyl)methanol.
| Compound Name | (2,5-dichloro-4-morpholin-4-ylsulfonylphenyl)methanol |
|---|---|
| PubChem CID | 59093503 |
| Molecular Formula | C11H13Cl2NO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | (2,5-dichloro-4-morpholin-4-ylsulfonylphenyl)methanol |
| SMILES | O=S(=O)(c1cc(Cl)c(CO)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C11H13Cl2NO4S/c12-9-6-11(10(13)5-8(9)7-15)19(16,17)14-1-3-18-4-2-14/h5-6,15H,1-4,7H2 |
| InChIKey | GDKGTJOEXVWEHA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |