C11H14FNO4S — CID 102919669
(4-fluoro-2-morpholin-4-ylsulfonylphenyl)methanol (PubChem CID 102919669) has the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. Its IUPAC name is (4-fluoro-2-morpholin-4-ylsulfonylphenyl)methanol.
| Compound Name | (4-fluoro-2-morpholin-4-ylsulfonylphenyl)methanol |
|---|---|
| PubChem CID | 102919669 |
| Molecular Formula | C11H14FNO4S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (4-fluoro-2-morpholin-4-ylsulfonylphenyl)methanol |
| SMILES | O=S(=O)(c1cc(F)ccc1CO)N1CCOCC1 |
| InChI | InChI=1S/C11H14FNO4S/c12-10-2-1-9(8-14)11(7-10)18(15,16)13-3-5-17-6-4-13/h1-2,7,14H,3-6,8H2 |
| InChIKey | ISPQZKLIQCNRCF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |