C11H16ClFN2O3S — CID 66878651
(5-fluoro-2-morpholin-4-ylsulfonylphenyl)methanamine;hydrochloride (PubChem CID 66878651) has the molecular formula C11H16ClFN2O3S and a molecular weight of 310.78 g/mol. Its IUPAC name is (5-fluoro-2-morpholin-4-ylsulfonylphenyl)methanamine;hydrochloride.
| Compound Name | (5-fluoro-2-morpholin-4-ylsulfonylphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 66878651 |
| Molecular Formula | C11H16ClFN2O3S |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (5-fluoro-2-morpholin-4-ylsulfonylphenyl)methanamine;hydrochloride |
| SMILES | Cl.NCc1cc(F)ccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H15FN2O3S.ClH/c12-10-1-2-11(9(7-10)8-13)18(15,16)14-3-5-17-6-4-14;/h1-2,7H,3-6,8,13H2;1H |
| InChIKey | ISLSRDNMJDZTSW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |