C13H18FNO5S — CID 103541161
[2-(3,4-dimethoxypyrrolidin-1-yl)sulfonyl-4-fluorophenyl]methanol (PubChem CID 103541161) has the molecular formula C13H18FNO5S and a molecular weight of 319.35 g/mol. Its IUPAC name is [2-(3,4-dimethoxypyrrolidin-1-yl)sulfonyl-4-fluorophenyl]methanol.
| Compound Name | [2-(3,4-dimethoxypyrrolidin-1-yl)sulfonyl-4-fluorophenyl]methanol |
|---|---|
| PubChem CID | 103541161 |
| Molecular Formula | C13H18FNO5S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | [2-(3,4-dimethoxypyrrolidin-1-yl)sulfonyl-4-fluorophenyl]methanol |
| SMILES | COC1CN(S(=O)(=O)c2cc(F)ccc2CO)CC1OC |
| InChI | InChI=1S/C13H18FNO5S/c1-19-11-6-15(7-12(11)20-2)21(17,18)13-5-10(14)4-3-9(13)8-16/h3-5,11-12,16H,6-8H2,1-2H3 |
| InChIKey | OYZJNNFRYNZKRV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |