C14H20FNO4S — CID 102970770
[4-fluoro-3-(3-methoxy-4-methylpiperidin-1-yl)sulfonylphenyl]methanol (PubChem CID 102970770) has the molecular formula C14H20FNO4S and a molecular weight of 317.38 g/mol. Its IUPAC name is [4-fluoro-3-(3-methoxy-4-methylpiperidin-1-yl)sulfonylphenyl]methanol.
| Compound Name | [4-fluoro-3-(3-methoxy-4-methylpiperidin-1-yl)sulfonylphenyl]methanol |
|---|---|
| PubChem CID | 102970770 |
| Molecular Formula | C14H20FNO4S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [4-fluoro-3-(3-methoxy-4-methylpiperidin-1-yl)sulfonylphenyl]methanol |
| SMILES | COC1CN(S(=O)(=O)c2cc(CO)ccc2F)CCC1C |
| InChI | InChI=1S/C14H20FNO4S/c1-10-5-6-16(8-13(10)20-2)21(18,19)14-7-11(9-17)3-4-12(14)15/h3-4,7,10,13,17H,5-6,8-9H2,1-2H3 |
| InChIKey | UMVNMRWZKPZGPP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |