C13H16FNO3S — CID 106317053
[4-fluoro-2-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanol (PubChem CID 106317053) has the molecular formula C13H16FNO3S and a molecular weight of 285.34 g/mol. Its IUPAC name is [4-fluoro-2-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanol.
| Compound Name | [4-fluoro-2-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanol |
|---|---|
| PubChem CID | 106317053 |
| Molecular Formula | C13H16FNO3S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | [4-fluoro-2-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanol |
| SMILES | CC1=CCCN(S(=O)(=O)c2cc(F)ccc2CO)C1 |
| InChI | InChI=1S/C13H16FNO3S/c1-10-3-2-6-15(8-10)19(17,18)13-7-12(14)5-4-11(13)9-16/h3-5,7,16H,2,6,8-9H2,1H3 |
| InChIKey | YAJYSPDZCORZFR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|