C13H15BrFNO3S — CID 106317050
[5-bromo-2-fluoro-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanol (PubChem CID 106317050) has the molecular formula C13H15BrFNO3S and a molecular weight of 364.24 g/mol. Its IUPAC name is [5-bromo-2-fluoro-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanol.
| Compound Name | [5-bromo-2-fluoro-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanol |
|---|---|
| PubChem CID | 106317050 |
| Molecular Formula | C13H15BrFNO3S |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | [5-bromo-2-fluoro-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanol |
| SMILES | CC1=CCCN(S(=O)(=O)c2cc(Br)cc(CO)c2F)C1 |
| InChI | InChI=1S/C13H15BrFNO3S/c1-9-3-2-4-16(7-9)20(18,19)12-6-11(14)5-10(8-17)13(12)15/h3,5-6,17H,2,4,7-8H2,1H3 |
| InChIKey | FJYTVOASKRRTFX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|