C13H16F2N2O2S — CID 106317273
[3,4-difluoro-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanamine (PubChem CID 106317273) has the molecular formula C13H16F2N2O2S and a molecular weight of 302.35 g/mol. Its IUPAC name is [3,4-difluoro-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanamine.
| Compound Name | [3,4-difluoro-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanamine |
|---|---|
| PubChem CID | 106317273 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [3,4-difluoro-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanamine |
| SMILES | CC1=CCCN(S(=O)(=O)c2cc(CN)cc(F)c2F)C1 |
| InChI | InChI=1S/C13H16F2N2O2S/c1-9-3-2-4-17(8-9)20(18,19)12-6-10(7-16)5-11(14)13(12)15/h3,5-6H,2,4,7-8,16H2,1H3 |
| InChIKey | WYMJDPZJDUMUAR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|