C12H14F2N2O2S — CID 105123683
[3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4,5-difluorophenyl]methanamine (PubChem CID 105123683) has the molecular formula C12H14F2N2O2S and a molecular weight of 288.32 g/mol. Its IUPAC name is [3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4,5-difluorophenyl]methanamine.
| Compound Name | [3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4,5-difluorophenyl]methanamine |
|---|---|
| PubChem CID | 105123683 |
| Molecular Formula | C12H14F2N2O2S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4,5-difluorophenyl]methanamine |
| SMILES | NCc1cc(F)c(F)c(S(=O)(=O)N2CC=CCC2)c1 |
| InChI | InChI=1S/C12H14F2N2O2S/c13-10-6-9(8-15)7-11(12(10)14)19(17,18)16-4-2-1-3-5-16/h1-2,6-7H,3-5,8,15H2 |
| InChIKey | VZOZPDHRKQFTQN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|