C14H18ClF2NO2S — CID 105118250
1-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-4-ethylpiperidine (PubChem CID 105118250) has the molecular formula C14H18ClF2NO2S and a molecular weight of 337.82 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-4-ethylpiperidine.
| Compound Name | 1-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-4-ethylpiperidine |
|---|---|
| PubChem CID | 105118250 |
| Molecular Formula | C14H18ClF2NO2S |
| Molecular Weight | 337.82 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[5-(chloromethyl)-2,3-difluorophenyl]sulfonyl-4-ethylpiperidine |
| SMILES | CCC1CCN(S(=O)(=O)c2cc(CCl)cc(F)c2F)CC1 |
| InChI | InChI=1S/C14H18ClF2NO2S/c1-2-10-3-5-18(6-4-10)21(19,20)13-8-11(9-15)7-12(16)14(13)17/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | JWWNYIJRGIIEIG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.82 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|