C10H10ClF2NO2S — CID 105118067
5-(chloromethyl)-N-cyclopropyl-2,3-difluorobenzenesulfonamide (PubChem CID 105118067) has the molecular formula C10H10ClF2NO2S and a molecular weight of 281.71 g/mol. Its IUPAC name is 5-(chloromethyl)-N-cyclopropyl-2,3-difluorobenzenesulfonamide.
| Compound Name | 5-(chloromethyl)-N-cyclopropyl-2,3-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 105118067 |
| Molecular Formula | C10H10ClF2NO2S |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 5-(chloromethyl)-N-cyclopropyl-2,3-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1cc(CCl)cc(F)c1F |
| InChI | InChI=1S/C10H10ClF2NO2S/c11-5-6-3-8(12)10(13)9(4-6)17(15,16)14-7-1-2-7/h3-4,7,14H,1-2,5H2 |
| InChIKey | BNPOIWLMHOJPNM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|