C14H20FNO3S2 — CID 106000964
2-fluoro-5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)benzenesulfonamide (PubChem CID 106000964) has the molecular formula C14H20FNO3S2 and a molecular weight of 333.45 g/mol. Its IUPAC name is 2-fluoro-5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)benzenesulfonamide.
| Compound Name | 2-fluoro-5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106000964 |
| Molecular Formula | C14H20FNO3S2 |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-fluoro-5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)benzenesulfonamide |
| SMILES | CSC1CCC(NS(=O)(=O)c2cc(CO)ccc2F)CC1 |
| InChI | InChI=1S/C14H20FNO3S2/c1-20-12-5-3-11(4-6-12)16-21(18,19)14-8-10(9-17)2-7-13(14)15/h2,7-8,11-12,16-17H,3-6,9H2,1H3 |
| InChIKey | NEXBYBJDFXEKOY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |